cas: 64231-55-6 — see every product listed under this CAS number, including other names
4-Fluoro-L-phenylalanine methyl ester hydrochloride, 97% (CAS 64231-55-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493340-5G |
| cas | 64231-55-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 742.46 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 64231-55-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: FHEHCZJLZDLUAW-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | FHEHCZJLZDLUAW-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)