cas: 55661-08-0 — see every product listed under this CAS number, including other names
4-Methoxy-2,6-dimethylbenzene-1-sulfonyl chloride (CAS 55661-08-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330126-1G |
| cas | 55661-08-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1320.39 Pln | |
| Fluorochem | 10g | 7380.75 Pln |
| delivery time | 3-4 weeks |
|---|
4-methoxy-2,6-dimethylbenzenesulfonyl chloride (CAS 55661-08-0) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzenesulfonyl chloride. InChIKey: FARJAHHRGCAAOY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-methoxy-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | FARJAHHRGCAAOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)OC |
Computed by PubChem (NCBI)