cas: 55661-08-0 — see every product listed under this CAS number, including other names
4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride 95% (CAS 55661-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133898-100mg |
| cas | 55661-08-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2740.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A133898 |
4-methoxy-2,6-dimethylbenzenesulfonyl chloride (CAS 55661-08-0) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzenesulfonyl chloride. InChIKey: FARJAHHRGCAAOY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-methoxy-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | FARJAHHRGCAAOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)OC |
Computed by PubChem (NCBI)