cas: 55661-08-0 — see every product listed under this CAS number, including other names
4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride, 95%, 95% (CAS 55661-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LM0-100mg |
| cas | 55661-08-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2109.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-2,6-dimethylbenzenesulfonyl chloride (CAS 55661-08-0) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzenesulfonyl chloride. InChIKey: FARJAHHRGCAAOY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-methoxy-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | FARJAHHRGCAAOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)OC |
Computed by PubChem (NCBI)