4-Pyridinecarboxylic acid, 2,5-dibromo-, 97%, 97%
cas: 942473-59-8 — see every product listed under this CAS number, including other names
4-Pyridinecarboxylic acid, 2,5-dibromo-, 97%, 97% (CAS 942473-59-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUA4-250mg |
| cas | 942473-59-8 |
| size | 250mg |
| availability | 150g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 640.40 Pln | |
| Chemat | 100g | 2382.80 Pln | |
| Chemat | 50g | 1221.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-dibromopyridine-4-carboxylic acid (CAS 942473-59-8) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-4-carboxylic acid. InChIKey: CLIZDLYBXIPXCR-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-4-carboxylic acid |
| InChIKey | CLIZDLYBXIPXCR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)