cas: 2241588-86-1 — see every product listed under this CAS number, including other names
4-methyl-6-oxo-1,6-dihydropyridine-3-sulfonyl chloride, 98% (CAS 2241588-86-1) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1272452-5g |
| cas | 2241588-86-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13571.74 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride (CAS 2241588-86-1) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride. InChIKey: INZXGJVKVJIBFZ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride |
| InChIKey | INZXGJVKVJIBFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)