Products 312300-42-8

CAS 312300-42-8 appears in our catalog under these names: 6-Methoxypyridine-3-sulfonyl chloride, 97%, 6-Methoxypyridine-3-sulfonyl chloride 95%, 6-Methoxypyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g, 250g.

Structural formula: {0} (CAS {1})

6-methoxypyridine-3-sulfonyl chloride (CAS 312300-42-8) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 6-methoxypyridine-3-sulfonyl chloride. InChIKey: OMLIVJOTRYWHNY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO3S
Molecular weight207.64 g/mol
IUPAC name6-methoxypyridine-3-sulfonyl chloride
InChIKeyOMLIVJOTRYWHNY-UHFFFAOYSA-N
SMILESCOC1=NC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)