Products 2344680-22-2
CAS 2344680-22-2 is the registry number for 3-Cyclopropylisoxazole-5-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-1,2-oxazole-5-sulfonyl chloride (CAS 2344680-22-2) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 3-cyclopropyl-1,2-oxazole-5-sulfonyl chloride. InChIKey: JRBGTKYWJCIGHD-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 3-cyclopropyl-1,2-oxazole-5-sulfonyl chloride |
| InChIKey | JRBGTKYWJCIGHD-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)