Products 1785316-68-8

CAS 1785316-68-8 is the registry number for 1-Methyl-2-oxo-1,2-dihydropyridine-3-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-methyl-2-oxopyridine-3-sulfonyl chloride (CAS 1785316-68-8) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 1-methyl-2-oxopyridine-3-sulfonyl chloride. InChIKey: FSUXFVJIMTUMJP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO3S
Molecular weight207.64 g/mol
IUPAC name1-methyl-2-oxopyridine-3-sulfonyl chloride
InChIKeyFSUXFVJIMTUMJP-UHFFFAOYSA-N
SMILESCN1C=CC=C(C1=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)