Products 219715-44-3
CAS 219715-44-3 appears in our catalog under these names: 2-Methoxy-3-pyridinesulfonyl Chloride, 2-Methoxypyridine-3-sulfonyl chloride 98+%, 2-Methoxypyridine-3-sulfonyl chloride, 97%, 2-Methoxypyridine-3-sulfonyl chloride, 97%, 97%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 100g, 250mg, 10g.
2-methoxypyridine-3-sulfonyl chloride (CAS 219715-44-3) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 2-methoxypyridine-3-sulfonyl chloride. InChIKey: LYKXXCYWOSGOIA-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 2-methoxypyridine-3-sulfonyl chloride |
| InChIKey | LYKXXCYWOSGOIA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)