CAS 1783716-56-2 is the registry number for 1-Methyl-2-oxo-1,2-dihydropyridine-4-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-2-oxopyridine-4-sulfonyl chloride (CAS 1783716-56-2) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 1-methyl-2-oxopyridine-4-sulfonyl chloride. InChIKey: QTUYDKKJDGINMY-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 1-methyl-2-oxopyridine-4-sulfonyl chloride |
| InChIKey | QTUYDKKJDGINMY-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=CC1=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)