Products 3479-10-5

CAS 3479-10-5 is the registry number for 2-Amino-4-chlorobenzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-4-chlorobenzenesulfonic acid (CAS 3479-10-5) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 2-amino-4-chlorobenzenesulfonic acid. InChIKey: OMQCGHBXGJBBOL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO3S
Molecular weight207.64 g/mol
IUPAC name2-amino-4-chlorobenzenesulfonic acid
InChIKeyOMQCGHBXGJBBOL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)N)S(=O)(=O)O

Computed by PubChem (NCBI)