CAS 945257-53-4 is the registry number for 4-Methoxy-3-pyridinesulfonyl Chloride. Offered by: TRC. Available pack sizes: 1g.
4-methoxypyridine-3-sulfonyl chloride (CAS 945257-53-4) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 4-methoxypyridine-3-sulfonyl chloride. InChIKey: HZXCJVXFYRJJJR-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 4-methoxypyridine-3-sulfonyl chloride |
| InChIKey | HZXCJVXFYRJJJR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=NC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)