CAS 2241588-86-1 appears in our catalog under these names: 4-Methyl-6-oxo-1,6-dihydro-pyridine-3-sulfonyl chloride, 95%, 6-Hydroxy-4-methyl-pyridine-3-sulfonyl chloride, 95%, 4-methyl-6-oxo-1,6-dihydropyridine-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride (CAS 2241588-86-1) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride. InChIKey: INZXGJVKVJIBFZ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride |
| InChIKey | INZXGJVKVJIBFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)