Products 2241588-86-1

CAS 2241588-86-1 appears in our catalog under these names: 4-Methyl-6-oxo-1,6-dihydro-pyridine-3-sulfonyl chloride, 95%, 6-Hydroxy-4-methyl-pyridine-3-sulfonyl chloride, 95%, 4-methyl-6-oxo-1,6-dihydropyridine-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride (CAS 2241588-86-1) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride. InChIKey: INZXGJVKVJIBFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO3S
Molecular weight207.64 g/mol
IUPAC name4-methyl-6-oxo-1H-pyridine-3-sulfonyl chloride
InChIKeyINZXGJVKVJIBFZ-UHFFFAOYSA-N
SMILESCC1=CC(=O)NC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)