CAS 23202-61-1 appears in our catalog under these names: 2-Chloro-4-hydroxybenzene-1-sulfonamide, 2-Chloro-4-hydroxybenzenesulfonamide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
2-chloro-4-hydroxybenzenesulfonamide (CAS 23202-61-1) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 2-chloro-4-hydroxybenzenesulfonamide. InChIKey: RYCUQSQJISLQFX-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 2-chloro-4-hydroxybenzenesulfonamide |
| InChIKey | RYCUQSQJISLQFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)