cas: 885-70-1 — see every product listed under this CAS number, including other names
5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one, 98%, 98% (CAS 885-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115BX7-250mg |
| cas | 885-70-1 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 563.60 Pln | |
| Chemat | 25g | 2219.60 Pln | |
| Chemat | 100g | 7211.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one (CAS 885-70-1) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one. InChIKey: MIRBIZDDMSFTKY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one |
| InChIKey | MIRBIZDDMSFTKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)