LS-75, 99.31%
cas: 885-70-1 — see every product listed under this CAS number, including other names
LS-75, 99.31% (CAS 885-70-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 500 mg, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W156961-5 g |
| cas | 885-70-1 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 909.48 Pln | |
| MedChemExpress | 1 g | 389.35 Pln | |
| MedChemExpress | 500 mg | 287.18 Pln | |
| MedChemExpress | 10 g | 1415.68 Pln | |
| MedChemExpress | 25 g | 2711.35 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.31% |
5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one (CAS 885-70-1) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one. InChIKey: MIRBIZDDMSFTKY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one |
| InChIKey | MIRBIZDDMSFTKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one, 5,11-Dihydro-6H-pyrido(2,3-b)(1,4)benzodiazepin-6-one, 5,11-dihydropyrido[2,3-b][1,4]benzodiazepin-6-one, 5,6-Dihydro-6-oxo-11H-pyrido[2,3-b][1,4]benzodiazepine, 5,6-Dihydro-6-oxo-11H-pyrido-[2,3-b][1,4]benzodiazepine, 11H-Pyrido[2,3-b][1,4]benzodiazepin-6(5H)-one, Pirenzepine EP Impurity B, Oprea1_042957, orb3026202, 2,4,9-triazatricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one