5,6,7-Trimethoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 95%
cas: 124346-74-3 — see every product listed under this CAS number, including other names
5,6,7-Trimethoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 95% (CAS 124346-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A413805-100mg |
| cas | 124346-74-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1321.56 Pln | |
| BLDpharm | 100mg | 430.98 Pln | |
| BLDpharm | 250mg | 608.70 Pln | |
| BLDpharm | 1g | 1419.52 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1566.80 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2918.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione (CAS 124346-74-3) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: DRDVRYQYAJVTJF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | DRDVRYQYAJVTJF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)NC(=O)OC2=O)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
5,6,7-Trimethoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione, 5,6,7-trimethoxy-1H-[3,1]benzoxazine-2,4-dione, 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-quinone, 2H-3,1-Benzoxazine-2,4(1H)-dione, 5,6,7-trimethoxy-, 5,6,7-trimethoxy-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione, 5,6,7-trimethoxy-2H-benzo[d][1,3]oxazine-2,4(1H)-dione