CAS 124346-74-3 appears in our catalog under these names: 5,6,7-Trimethoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 95%, 95%, 5,6,7-TRIMETHOXY-1H-BENZO[D][1,3]OXAZINE-2,4-DIONE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione (CAS 124346-74-3) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: DRDVRYQYAJVTJF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 5,6,7-trimethoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | DRDVRYQYAJVTJF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)NC(=O)OC2=O)OC)OC |
Computed by PubChem (NCBI)