cas: 162327-73-3 — see every product listed under this CAS number, including other names
5,6-Dichloro-N-methoxy-N-methylpyridine-3-carboxamide, 95%, 95% (CAS 162327-73-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYQZ-250mg |
| cas | 162327-73-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1336.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide (CAS 162327-73-3) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide. InChIKey: YZINVISHQNRXPV-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide |
| InChIKey | YZINVISHQNRXPV-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(N=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)