CAS 32022-41-6 is the registry number for 2-(3,4-Dichlorophenoxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenoxy)acetohydrazide (CAS 32022-41-6) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)acetohydrazide. InChIKey: ZJNOLANCJVKMLD-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)acetohydrazide |
| InChIKey | ZJNOLANCJVKMLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)