CAS 28267-53-0 is the registry number for N'-(2,4-Dichlorophenyl)-n-hydroxy-n-methylurea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2,4-dichlorophenyl)-1-hydroxy-1-methylurea (CAS 28267-53-0) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-1-hydroxy-1-methylurea. InChIKey: XTZKSJGASNPSNO-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-1-hydroxy-1-methylurea |
| InChIKey | XTZKSJGASNPSNO-UHFFFAOYSA-N |
| SMILES | CN(C(=O)NC1=C(C=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)