CAS 1505966-87-9 is the registry number for Isopropyl 3,6-dichloropyridazine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Propan-2-yl 3,6-dichloropyridazine-4-carboxylate (CAS 1505966-87-9) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: propan-2-yl 3,6-dichloropyridazine-4-carboxylate. InChIKey: MREQTJYSBKUSHW-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | propan-2-yl 3,6-dichloropyridazine-4-carboxylate |
| InChIKey | MREQTJYSBKUSHW-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=NN=C1Cl)Cl |
Computed by PubChem (NCBI)