Products 1505966-87-9

CAS 1505966-87-9 is the registry number for Isopropyl 3,6-dichloropyridazine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Propan-2-yl 3,6-dichloropyridazine-4-carboxylate (CAS 1505966-87-9) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: propan-2-yl 3,6-dichloropyridazine-4-carboxylate. InChIKey: MREQTJYSBKUSHW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2N2O2
Molecular weight235.06 g/mol
IUPAC namepropan-2-yl 3,6-dichloropyridazine-4-carboxylate
InChIKeyMREQTJYSBKUSHW-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C1=CC(=NN=C1Cl)Cl

Computed by PubChem (NCBI)