CAS 28236-62-6 appears in our catalog under these names: 2,4-Dichlorophenoxyacetic acid hydrazide, 97%, 2-(2,4-Dichlorophenoxy)acetohydrazide, 2,4-Dichlorophenoxyacetic acid hydrazide, 98%, 98%, 2,4-Dichlorophenoxyacetic acid hydrazide, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10000mg, 100mg, 250mg, 500mg.
2-(2,4-dichlorophenoxy)acetohydrazide (CAS 28236-62-6) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)acetohydrazide. InChIKey: OEYOIIKYUVBUJN-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)acetohydrazide |
| InChIKey | OEYOIIKYUVBUJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)NN |
Computed by PubChem (NCBI)