CAS 79295-15-1 appears in our catalog under these names: 2-(2,4-Dichlorophenoxy)acetamidoxime, 95%, 2-(2,4-Dichlorophenoxy)-N'-hydroxyethanimidamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2,4-dichlorophenoxy)-N'-hydroxyethanimidamide (CAS 79295-15-1) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N'-hydroxyethanimidamide. InChIKey: BTOTVAISQCMDLO-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N'-hydroxyethanimidamide |
| InChIKey | BTOTVAISQCMDLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OC/C(=N/O)/N |
Computed by PubChem (NCBI)