CAS 32022-40-5 is the registry number for 2-(2,5-Dichlorophenoxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,5-dichlorophenoxy)acetohydrazide (CAS 32022-40-5) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,5-dichlorophenoxy)acetohydrazide. InChIKey: FXZGNSHGNWUJOJ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,5-dichlorophenoxy)acetohydrazide |
| InChIKey | FXZGNSHGNWUJOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(=O)NN)Cl |
Computed by PubChem (NCBI)