CAS 162327-73-3 appears in our catalog under these names: 5,6–Dichloro–N–methoxy–N–methylpyridine–3–carboxamide, 5,6-Dichloro-n-methoxy-n-methylpyridine-3-carboxamide, 97%, 5,6-Dichloro-N-methoxy-N-methylpyridine-3-carboxamide, 95%, 95%, 5,6-Dichloro-N-methoxy-N-methylnicotinamide, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 500mg, 1g, 5g.
5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide (CAS 162327-73-3) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide. InChIKey: YZINVISHQNRXPV-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 5,6-dichloro-N-methoxy-N-methylpyridine-3-carboxamide |
| InChIKey | YZINVISHQNRXPV-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(N=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)