Products 153860-25-4
CAS 153860-25-4 appears in our catalog under these names: 2-(2,3-Dichlorophenoxy)acetohydrazide, 98%, 2,3-Dichlorophenoxyacetic acid hydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g.
2-(2,3-dichlorophenoxy)acetohydrazide (CAS 153860-25-4) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,3-dichlorophenoxy)acetohydrazide. InChIKey: BHWOXDSGQNVQJA-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,3-dichlorophenoxy)acetohydrazide |
| InChIKey | BHWOXDSGQNVQJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCC(=O)NN |
Computed by PubChem (NCBI)