CAS 1418117-91-5 appears in our catalog under these names: Methyl 2,6-dichloro-3-(methylamino)isonicotinate, 97%, Methyl 2,6-dichloro-3-(methylamino)isonicotinate, 98%, Methyl 2,6–Dichloro–3–(methylamino)isonicotinate, Methyl 2,6-dichloro-3-(methylamino)isonicotinate. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Methyl 2,6-dichloro-3-(methylamino)pyridine-4-carboxylate (CAS 1418117-91-5) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 2,6-dichloro-3-(methylamino)pyridine-4-carboxylate. InChIKey: JRUXBJRCWKJHPR-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 2,6-dichloro-3-(methylamino)pyridine-4-carboxylate |
| InChIKey | JRUXBJRCWKJHPR-UHFFFAOYSA-N |
| SMILES | CNC1=C(N=C(C=C1C(=O)OC)Cl)Cl |
Computed by PubChem (NCBI)