cas: 4792-71-6 — see every product listed under this CAS number, including other names
5,7-Dichloro-1H-indole-2-carboxylic acid, 97%, 97% (CAS 4792-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D95T-100mg |
| cas | 4792-71-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 390.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-1H-indole-2-carboxylic acid (CAS 4792-71-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: QILAXMNESNFYJG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | QILAXMNESNFYJG-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)