5,7-Dichloro-2-ethyl-2H-pyrazolo[4,3-d]pyrimidine, 97%
cas: 1823331-38-9 — see every product listed under this CAS number, including other names
5,7-Dichloro-2-ethyl-2H-pyrazolo[4,3-d]pyrimidine, 97% (CAS 1823331-38-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1134NJ-100mg |
| cas | 1823331-38-9 |
| size | 100mg |
| availability | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 962.00 Pln | |
| Chemat | 500mg | 1355.60 Pln | |
| Chemat | 1g | 1989.20 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1778.56 Pln | |
| Fluorochem | 500mg | 2517.88 Pln | |
| Fluorochem | 1g | 3678.93 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine (CAS 1823331-38-9) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine. InChIKey: BWHAJCRXKMRHKV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine |
| InChIKey | BWHAJCRXKMRHKV-UHFFFAOYSA-N |
| SMILES | CCN1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)