5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine, 98%
cas: 108656-65-1 — see every product listed under this CAS number, including other names
5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine, 98% (CAS 108656-65-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A711951-10g |
| cas | 108656-65-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11801.02 Pln | |
| AmBeed | 100mg | 577.78 Pln | |
| AmBeed | 5g | 7608.58 Pln | |
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 500mg | 1106.92 Pln | |
| Fluorochem | 1g | 1492.20 Pln | |
| Fluorochem | 2.5g | 2778.21 Pln | |
| Fluorochem | 5g | 4616.10 Pln | |
| Fluorochem | 10g | 7432.82 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine (CAS 108656-65-1) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: GQKBSBAYTFZMIR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | GQKBSBAYTFZMIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(S2)N |
Computed by PubChem (NCBI)