CAS 108656-65-1 appears in our catalog under these names: 5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine, 98%, 5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine, 5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 5g, 2,5g, 250mg, 1g, 500mg, 2.5g.
5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine (CAS 108656-65-1) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: GQKBSBAYTFZMIR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | GQKBSBAYTFZMIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(S2)N |
Computed by PubChem (NCBI)