Products 1094373-80-4
CAS 1094373-80-4 appears in our catalog under these names: 2-(5-Bromothiophen-2-yl)pyrimidin-5-amine, 95%, 2-(5-Bromothiophen-2-yl)pyrimidin-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(5-bromothiophen-2-yl)pyrimidin-5-amine (CAS 1094373-80-4) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 2-(5-bromothiophen-2-yl)pyrimidin-5-amine. InChIKey: LTHVYBFNPHBNHI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 2-(5-bromothiophen-2-yl)pyrimidin-5-amine |
| InChIKey | LTHVYBFNPHBNHI-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=NC=C(C=N2)N |
Computed by PubChem (NCBI)