CAS 1226154-37-5 appears in our catalog under these names: 6-(5-Bromothiophen-2-yl)pyridazin-3-amine, 6-(5-Bromothiophen-2-yl)pyridazin-3-amine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
6-(5-bromothiophen-2-yl)pyridazin-3-amine (CAS 1226154-37-5) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 6-(5-bromothiophen-2-yl)pyridazin-3-amine. InChIKey: AFRBAPJZZUACDD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 6-(5-bromothiophen-2-yl)pyridazin-3-amine |
| InChIKey | AFRBAPJZZUACDD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN=C1C2=CC=C(S2)Br)N |
Computed by PubChem (NCBI)