CAS 1153976-85-2 appears in our catalog under these names: 3-(4-Bromophenyl)-5-amino-(1,2,4)thiadiazole, 97%, 3-(4-bromophenyl)-1,2,4-thiadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(4-bromophenyl)-1,2,4-thiadiazol-5-amine (CAS 1153976-85-2) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 3-(4-bromophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: NMTGWXGNMOHUOO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | NMTGWXGNMOHUOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)N)Br |
Computed by PubChem (NCBI)