cas: 887408-09-5 — see every product listed under this CAS number, including other names
5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 887408-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A2DE-1mg |
| cas | 887408-09-5 |
| size | 1mg |
| availability | 0.005g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 194.00 Pln | |
| Chemat | 5mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 887408-09-5) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: QYWAKMRGJVKMRO-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | QYWAKMRGJVKMRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NO2)C(=O)O)Cl |
Computed by PubChem (NCBI)