cas: 4368-83-6 — see every product listed under this CAS number, including other names
5-Acetamido-2-nitrobenzoic acid, 98%, 98% (CAS 4368-83-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MBL-1g |
| cas | 4368-83-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 15g | 328.40 Pln | |
| Chemat | 25g | 371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-acetylamino-2-nitrobenzoic acid is an amidobenzoic acid that is benzoic acid substituted by an acetoamido group at position 5 and a nitro group at position 2 respectively. It is a C-nitro compound and an amidobenzoic acid.
Source: ChEBI
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 5-acetamido-2-nitrobenzoic acid |
| InChIKey | ZSHFMOUMOUOGKI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)