cas: 489-78-1 — see every product listed under this CAS number, including other names
5-Amino-1-naphthol-3-sulfonic Acid Hydrate, 97.0%, 97.0% (CAS 489-78-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MCR-25g |
| cas | 489-78-1 |
| size | 25g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 131.60 Pln | |
| Chemat | 500g | 504.00 Pln |
| purity | 97.0% |
|---|---|
| delivery time | 3 weeks |
8-amino-4-hydroxynaphthalene-2-sulfonic acid (CAS 489-78-1) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 8-amino-4-hydroxynaphthalene-2-sulfonic acid. InChIKey: GGZZISOUXJHYOY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 8-amino-4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | GGZZISOUXJHYOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2O)S(=O)(=O)O)C(=C1)N |
Computed by PubChem (NCBI)