CAS 40506-05-6 is the registry number for 2-(2-Oxopropyl)-1,2-benzisothiazol-3(2h)-one 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one (CAS 40506-05-6) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one. InChIKey: FIKYUYWVOVLHRS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one |
| InChIKey | FIKYUYWVOVLHRS-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)