CAS 1554072-83-1 appears in our catalog under these names: 5-Methanesulfonyl-1h-indole-3-carboxylic acid, 95%, 5-Methanesulfonyl-1h-indole-3-carboxylic acid, 97%, 5-Methanesulfonyl-1h-indole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
5-methylsulfonyl-1H-indole-3-carboxylic acid (CAS 1554072-83-1) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 5-methylsulfonyl-1H-indole-3-carboxylic acid. InChIKey: AFEUOABSCCVYMF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 5-methylsulfonyl-1H-indole-3-carboxylic acid |
| InChIKey | AFEUOABSCCVYMF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NC=C2C(=O)O |
Computed by PubChem (NCBI)