CAS 923710-57-0 appears in our catalog under these names: 5-Ethoxy-2-thien-2-yl-1,3-oxazole-4-carboxylic acid, 95%, 5-Ethoxy-2-(thiophen-2-yl)oxazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-ethoxy-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid (CAS 923710-57-0) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 5-ethoxy-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid. InChIKey: QKPNHNBCKNWOFO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 5-ethoxy-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid |
| InChIKey | QKPNHNBCKNWOFO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(N=C(O1)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)