Products 868238-01-1

CAS 868238-01-1 is the registry number for 3-[(Prop-2-ynylamino)sulfonyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(prop-2-ynylsulfamoyl)benzoic acid (CAS 868238-01-1) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 3-(prop-2-ynylsulfamoyl)benzoic acid. InChIKey: JXDOWVPMLOMFRR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO4S
Molecular weight239.25 g/mol
IUPAC name3-(prop-2-ynylsulfamoyl)benzoic acid
InChIKeyJXDOWVPMLOMFRR-UHFFFAOYSA-N
SMILESC#CCNS(=O)(=O)C1=CC=CC(=C1)C(=O)O

Computed by PubChem (NCBI)