CAS 1707586-40-0 appears in our catalog under these names: Methyl 3-amino-1-benzothiophene-2-carboxylate 1,1-dioxide, 90%, Methyl 3-amino-1-benzothiophene-2-carboxylate 1,1-dioxide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
Methyl 3-amino-1,1-dioxo-1-benzothiophene-2-carboxylate (CAS 1707586-40-0) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: methyl 3-amino-1,1-dioxo-1-benzothiophene-2-carboxylate. InChIKey: OYSLOSRUTHMUMB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | methyl 3-amino-1,1-dioxo-1-benzothiophene-2-carboxylate |
| InChIKey | OYSLOSRUTHMUMB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2S1(=O)=O)N |
Computed by PubChem (NCBI)