CAS 489-78-1 appears in our catalog under these names: 5-Amino-1-naphthol-3-sulfonic acid hydrate, 98%, 5-Amino-1-naphthol-3-sulfonic acid, 95%, 8-Amino-4-hydroxynaphthalene-2-sulfonic acid, 98%, 5–Amino–1–naphthol–3–sulfonic Acid Hydrate, 5-Amino-1-naphthol-3-sulfonic Acid, >97.0%(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 500g.
8-amino-4-hydroxynaphthalene-2-sulfonic acid (CAS 489-78-1) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 8-amino-4-hydroxynaphthalene-2-sulfonic acid. InChIKey: GGZZISOUXJHYOY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 8-amino-4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | GGZZISOUXJHYOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2O)S(=O)(=O)O)C(=C1)N |
Computed by PubChem (NCBI)