CAS 383132-63-6 appears in our catalog under these names: 6-(Methylsulfonyl)-1h-indole-2-carboxylic acid, 96%, 6-(Methylsulfonyl)-1H-indole-2-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
6-methylsulfonyl-1H-indole-2-carboxylic acid (CAS 383132-63-6) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 6-methylsulfonyl-1H-indole-2-carboxylic acid. InChIKey: ORTLANQKWQFYJS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 6-methylsulfonyl-1H-indole-2-carboxylic acid |
| InChIKey | ORTLANQKWQFYJS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)