CAS 300700-05-4 appears in our catalog under these names: 2-((4-Cyanophenyl)methanesulfonyl)acetic acid, 2-((4-Cyanophenyl)methanesulfonyl)acetic acid, 95%, 2-([(4-Cyanophenyl)methane]sulfonyl)acetic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 100mg, 1g, 10g, 5g, 250mg.
2-[(4-cyanophenyl)methylsulfonyl]acetic acid (CAS 300700-05-4) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 2-[(4-cyanophenyl)methylsulfonyl]acetic acid. InChIKey: DGZLPEXTGJUEHL-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 2-[(4-cyanophenyl)methylsulfonyl]acetic acid |
| InChIKey | DGZLPEXTGJUEHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)CC(=O)O)C#N |
Computed by PubChem (NCBI)