CAS 881044-61-7 is the registry number for (2,3-Dihydro-1,4-benzodioxin-6-ylsulfonyl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)acetonitrile (CAS 881044-61-7) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)acetonitrile. InChIKey: MKLQRUHBXYASQJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)acetonitrile |
| InChIKey | MKLQRUHBXYASQJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)