cas: 2096335-69-0 — see every product listed under this CAS number, including other names
5-Benzyloxy-2,4-difluorophenylboronic acid, 97% (CAS 2096335-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623211-1G |
| cas | 2096335-69-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1153.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,4-difluoro-5-phenylmethoxyphenyl)boronic acid (CAS 2096335-69-0) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,4-difluoro-5-phenylmethoxyphenyl)boronic acid. InChIKey: PRNFGNBWYJGOGS-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,4-difluoro-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | PRNFGNBWYJGOGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)