cas: 1451391-73-3 — see every product listed under this CAS number, including other names
5-Carboxy-2-ethoxyphenylboronic acid, 97%, 97% (CAS 1451391-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXDJ-100mg |
| cas | 1451391-73-3 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 678.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-borono-4-ethoxybenzoic acid (CAS 1451391-73-3) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: 3-borono-4-ethoxybenzoic acid. InChIKey: CMUVOHRXIPPHFW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 3-borono-4-ethoxybenzoic acid |
| InChIKey | CMUVOHRXIPPHFW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)OCC)(O)O |
Computed by PubChem (NCBI)